3-methoxy-1-[1-(thiophene-2-sulfonyl)piperidin-4-yl]-7-oxa-1-azaspiro[3.5]nonan-2-one
Chemical Structure Depiction of
3-methoxy-1-[1-(thiophene-2-sulfonyl)piperidin-4-yl]-7-oxa-1-azaspiro[3.5]nonan-2-one
3-methoxy-1-[1-(thiophene-2-sulfonyl)piperidin-4-yl]-7-oxa-1-azaspiro[3.5]nonan-2-one
Compound characteristics
| Compound ID: | T965-0796 |
| Compound Name: | 3-methoxy-1-[1-(thiophene-2-sulfonyl)piperidin-4-yl]-7-oxa-1-azaspiro[3.5]nonan-2-one |
| Molecular Weight: | 400.51 |
| Molecular Formula: | C17 H24 N2 O5 S2 |
| Smiles: | COC1C(N(C2CCN(CC2)S(c2cccs2)(=O)=O)C12CCOCC2)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.1691 |
| logD: | 1.1691 |
| logSw: | -2.2253 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 62.843 |
| InChI Key: | URXVEISXHONNDQ-HNNXBMFYSA-N |