3-(cyclopropylmethoxy)-1-(1-propanoylpiperidin-4-yl)-7-oxa-1-azaspiro[3.5]nonan-2-one
Chemical Structure Depiction of
3-(cyclopropylmethoxy)-1-(1-propanoylpiperidin-4-yl)-7-oxa-1-azaspiro[3.5]nonan-2-one
3-(cyclopropylmethoxy)-1-(1-propanoylpiperidin-4-yl)-7-oxa-1-azaspiro[3.5]nonan-2-one
Compound characteristics
| Compound ID: | T965-0863 |
| Compound Name: | 3-(cyclopropylmethoxy)-1-(1-propanoylpiperidin-4-yl)-7-oxa-1-azaspiro[3.5]nonan-2-one |
| Molecular Weight: | 350.46 |
| Molecular Formula: | C19 H30 N2 O4 |
| Smiles: | CCC(N1CCC(CC1)N1C(C(C12CCOCC2)OCC1CC1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.3884 |
| logD: | 1.3884 |
| logSw: | -1.13 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.713 |
| InChI Key: | TXEBZNQEMHDQOU-KRWDZBQOSA-N |