6-methoxy-N-[rel-(1R,2S)-2-{[(2-methylphenyl)methyl]carbamoyl}cyclopentyl]pyridine-3-carboxamide
Chemical Structure Depiction of
6-methoxy-N-[rel-(1R,2S)-2-{[(2-methylphenyl)methyl]carbamoyl}cyclopentyl]pyridine-3-carboxamide
6-methoxy-N-[rel-(1R,2S)-2-{[(2-methylphenyl)methyl]carbamoyl}cyclopentyl]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | T987-3097 |
| Compound Name: | 6-methoxy-N-[rel-(1R,2S)-2-{[(2-methylphenyl)methyl]carbamoyl}cyclopentyl]pyridine-3-carboxamide |
| Molecular Weight: | 367.45 |
| Molecular Formula: | C21 H25 N3 O3 |
| Smiles: | Cc1ccccc1CNC([C@H]1CCC[C@H]1NC(c1ccc(nc1)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 2.8184 |
| logD: | 2.8183 |
| logSw: | -3.1961 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.128 |
| InChI Key: | CXKHRDSGCCDLRF-MSOLQXFVSA-N |