3-[4-(3,4-dimethylbenzene-1-sulfonyl)piperazin-1-yl]-1-methylpyrrolidin-2-one
Chemical Structure Depiction of
3-[4-(3,4-dimethylbenzene-1-sulfonyl)piperazin-1-yl]-1-methylpyrrolidin-2-one
3-[4-(3,4-dimethylbenzene-1-sulfonyl)piperazin-1-yl]-1-methylpyrrolidin-2-one
Compound characteristics
| Compound ID: | T990-3028 |
| Compound Name: | 3-[4-(3,4-dimethylbenzene-1-sulfonyl)piperazin-1-yl]-1-methylpyrrolidin-2-one |
| Molecular Weight: | 351.47 |
| Molecular Formula: | C17 H25 N3 O3 S |
| Smiles: | Cc1ccc(cc1C)S(N1CCN(CC1)C1CCN(C)C1=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.6787 |
| logD: | 1.6785 |
| logSw: | -2.4996 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 51.287 |
| InChI Key: | UTTQKLDCGUJZIL-INIZCTEOSA-N |