1-benzyl-3-[4-(4-methylpentanoyl)-1,4-diazepan-1-yl]pyrrolidin-2-one
Chemical Structure Depiction of
1-benzyl-3-[4-(4-methylpentanoyl)-1,4-diazepan-1-yl]pyrrolidin-2-one
1-benzyl-3-[4-(4-methylpentanoyl)-1,4-diazepan-1-yl]pyrrolidin-2-one
Compound characteristics
| Compound ID: | T991-0514 |
| Compound Name: | 1-benzyl-3-[4-(4-methylpentanoyl)-1,4-diazepan-1-yl]pyrrolidin-2-one |
| Molecular Weight: | 371.52 |
| Molecular Formula: | C22 H33 N3 O2 |
| Smiles: | CC(C)CCC(N1CCCN(CC1)C1CCN(Cc2ccccc2)C1=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4619 |
| logD: | 2.4487 |
| logSw: | -2.3817 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.313 |
| InChI Key: | XAXAHJXJUUAFLP-FQEVSTJZSA-N |