3-{4-[(3-chlorophenyl)acetyl]-1,4-diazepan-1-yl}-1-(2-methoxyethyl)pyrrolidin-2-one
Chemical Structure Depiction of
3-{4-[(3-chlorophenyl)acetyl]-1,4-diazepan-1-yl}-1-(2-methoxyethyl)pyrrolidin-2-one
3-{4-[(3-chlorophenyl)acetyl]-1,4-diazepan-1-yl}-1-(2-methoxyethyl)pyrrolidin-2-one
Compound characteristics
| Compound ID: | T991-1910 |
| Compound Name: | 3-{4-[(3-chlorophenyl)acetyl]-1,4-diazepan-1-yl}-1-(2-methoxyethyl)pyrrolidin-2-one |
| Molecular Weight: | 393.91 |
| Molecular Formula: | C20 H28 Cl N3 O3 |
| Smiles: | COCCN1CCC(C1=O)N1CCCN(CC1)C(Cc1cccc(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.6727 |
| logD: | 1.6315 |
| logSw: | -2.3604 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.634 |
| InChI Key: | DGDUPCAJOCLTBL-SFHVURJKSA-N |