2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide
2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | T992-0157 |
| Compound Name: | 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 300.23 |
| Molecular Formula: | C13 H11 F3 N2 O3 |
| Smiles: | Cc1c(C(Nc2ccc(cc2)OC(F)(F)F)=O)nc(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.4989 |
| logD: | 3.4989 |
| logSw: | -3.7777 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.393 |
| InChI Key: | QOZUSSNOUGCAOH-UHFFFAOYSA-N |