N,N-diethyl-2-[(3-fluoro-4-methylbenzamido)methyl]-5-methyl-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
N,N-diethyl-2-[(3-fluoro-4-methylbenzamido)methyl]-5-methyl-1,3-oxazole-4-carboxamide
N,N-diethyl-2-[(3-fluoro-4-methylbenzamido)methyl]-5-methyl-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | T993-1817 |
| Compound Name: | N,N-diethyl-2-[(3-fluoro-4-methylbenzamido)methyl]-5-methyl-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 347.39 |
| Molecular Formula: | C18 H22 F N3 O3 |
| Smiles: | CCN(CC)C(c1c(C)oc(CNC(c2ccc(C)c(c2)F)=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5883 |
| logD: | 2.588 |
| logSw: | -2.8238 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.148 |
| InChI Key: | LTCKCGFNUXBWIK-UHFFFAOYSA-N |