4-fluoro-N-[(4-fluorophenyl)methyl]-N-{[5-(2-methoxyphenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}benzamide
Chemical Structure Depiction of
4-fluoro-N-[(4-fluorophenyl)methyl]-N-{[5-(2-methoxyphenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}benzamide
4-fluoro-N-[(4-fluorophenyl)methyl]-N-{[5-(2-methoxyphenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}benzamide
Compound characteristics
| Compound ID: | V001-2094 |
| Compound Name: | 4-fluoro-N-[(4-fluorophenyl)methyl]-N-{[5-(2-methoxyphenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}benzamide |
| Molecular Weight: | 539.58 |
| Molecular Formula: | C32 H27 F2 N3 O3 |
| Smiles: | Cc1c(CN(Cc2ccc(cc2)F)C(c2ccc(cc2)F)=O)c(n(c2ccccc2)n1)Oc1ccccc1OC |
| Stereo: | ACHIRAL |
| logP: | 5.9991 |
| logD: | 5.9991 |
| logSw: | -5.6838 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 44.577 |
| InChI Key: | ZTYQOSYJXRRCFF-UHFFFAOYSA-N |