N-{2-[(4-{2-[(1,2-diphenylethyl)amino]-2-oxoethyl}-1,3-thiazol-2-yl)amino]-2-oxoethyl}-N-(propan-2-yl)benzamide
Chemical Structure Depiction of
N-{2-[(4-{2-[(1,2-diphenylethyl)amino]-2-oxoethyl}-1,3-thiazol-2-yl)amino]-2-oxoethyl}-N-(propan-2-yl)benzamide
N-{2-[(4-{2-[(1,2-diphenylethyl)amino]-2-oxoethyl}-1,3-thiazol-2-yl)amino]-2-oxoethyl}-N-(propan-2-yl)benzamide
Compound characteristics
| Compound ID: | V001-2759 |
| Compound Name: | N-{2-[(4-{2-[(1,2-diphenylethyl)amino]-2-oxoethyl}-1,3-thiazol-2-yl)amino]-2-oxoethyl}-N-(propan-2-yl)benzamide |
| Molecular Weight: | 540.68 |
| Molecular Formula: | C31 H32 N4 O3 S |
| Salt: | not_available |
| Smiles: | CC(C)N(CC(Nc1nc(CC(NC(Cc2ccccc2)c2ccccc2)=O)cs1)=O)C(c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5157 |
| logD: | 5.5137 |
| logSw: | -5.4669 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.443 |
| InChI Key: | DGXOYALBJFVRKK-MHZLTWQESA-N |