[4-(2-butyl-7-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl](4-methylphenyl)methanone
Chemical Structure Depiction of
[4-(2-butyl-7-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl](4-methylphenyl)methanone
[4-(2-butyl-7-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl](4-methylphenyl)methanone
Compound characteristics
| Compound ID: | V001-3177 |
| Compound Name: | [4-(2-butyl-7-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl](4-methylphenyl)methanone |
| Molecular Weight: | 462.66 |
| Molecular Formula: | C27 H34 N4 O S |
| Salt: | not_available |
| Smiles: | CCCCc1nc(c2c3CCC(C)Cc3sc2n1)N1CCN(CC1)C(c1ccc(C)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.815 |
| logD: | 6.3662 |
| logSw: | -5.8573 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 40.667 |
| InChI Key: | LPZLZNNBEZVIMX-LJQANCHMSA-N |