2-({[(2,4-dimethylphenyl)methyl](3-methylbutan-2-yl)amino}methyl)-N-[(4-fluorophenyl)methyl]-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
2-({[(2,4-dimethylphenyl)methyl](3-methylbutan-2-yl)amino}methyl)-N-[(4-fluorophenyl)methyl]-1,3-oxazole-4-carboxamide
2-({[(2,4-dimethylphenyl)methyl](3-methylbutan-2-yl)amino}methyl)-N-[(4-fluorophenyl)methyl]-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | V001-3380 |
| Compound Name: | 2-({[(2,4-dimethylphenyl)methyl](3-methylbutan-2-yl)amino}methyl)-N-[(4-fluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 437.56 |
| Molecular Formula: | C26 H32 F N3 O2 |
| Salt: | not_available |
| Smiles: | CC(C)C(C)N(Cc1ccc(C)cc1C)Cc1nc(co1)C(NCc1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6925 |
| logD: | 5.6907 |
| logSw: | -5.2511 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.025 |
| InChI Key: | YWWNIAIRIWKJDM-FQEVSTJZSA-N |