N~2~-[(3-chlorophenyl)carbamoyl]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]-N~2~-propylglycinamide
Chemical Structure Depiction of
N~2~-[(3-chlorophenyl)carbamoyl]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]-N~2~-propylglycinamide
N~2~-[(3-chlorophenyl)carbamoyl]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]-N~2~-propylglycinamide
Compound characteristics
| Compound ID: | V001-3490 |
| Compound Name: | N~2~-[(3-chlorophenyl)carbamoyl]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]-N~2~-propylglycinamide |
| Molecular Weight: | 488.02 |
| Molecular Formula: | C25 H27 Cl F N3 O2 S |
| Smiles: | CCCN(CC(N(Cc1ccc(cc1)F)Cc1c(C)ccs1)=O)C(Nc1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.7502 |
| logD: | 5.7502 |
| logSw: | -5.8329 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.951 |
| InChI Key: | RQRJKSPVXZHRHZ-UHFFFAOYSA-N |