1-{[(3,5-dimethoxyphenyl)methyl](2-methoxyethyl)amino}pentan-2-ol
Chemical Structure Depiction of
1-{[(3,5-dimethoxyphenyl)methyl](2-methoxyethyl)amino}pentan-2-ol
1-{[(3,5-dimethoxyphenyl)methyl](2-methoxyethyl)amino}pentan-2-ol
Compound characteristics
| Compound ID: | V001-4880 |
| Compound Name: | 1-{[(3,5-dimethoxyphenyl)methyl](2-methoxyethyl)amino}pentan-2-ol |
| Molecular Weight: | 311.42 |
| Molecular Formula: | C17 H29 N O4 |
| Salt: | not_available |
| Smiles: | CCCC(CN(CCOC)Cc1cc(cc(c1)OC)OC)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5275 |
| logD: | 0.2259 |
| logSw: | -2.1548 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.25 |
| InChI Key: | COCPOHDCHSDYDK-HNNXBMFYSA-N |