1-([1,1'-biphenyl]-4-yl)-4-[(2,4-difluorophenyl)methyl]-3-methylpiperazin-2-one
Chemical Structure Depiction of
1-([1,1'-biphenyl]-4-yl)-4-[(2,4-difluorophenyl)methyl]-3-methylpiperazin-2-one
1-([1,1'-biphenyl]-4-yl)-4-[(2,4-difluorophenyl)methyl]-3-methylpiperazin-2-one
Compound characteristics
| Compound ID: | V001-4910 |
| Compound Name: | 1-([1,1'-biphenyl]-4-yl)-4-[(2,4-difluorophenyl)methyl]-3-methylpiperazin-2-one |
| Molecular Weight: | 392.45 |
| Molecular Formula: | C24 H22 F2 N2 O |
| Salt: | not_available |
| Smiles: | CC1C(N(CCN1Cc1ccc(cc1F)F)c1ccc(cc1)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0391 |
| logD: | 5.039 |
| logSw: | -4.8541 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 18.9544 |
| InChI Key: | GDLYKGAWJCKWKE-KRWDZBQOSA-N |