1-(4-fluorophenyl)-3-(3-methylphenyl)-4-{4-[(4-methylphenyl)carbamamido]phenyl}-1H-pyrazol-5-yl acetate
Chemical Structure Depiction of
1-(4-fluorophenyl)-3-(3-methylphenyl)-4-{4-[(4-methylphenyl)carbamamido]phenyl}-1H-pyrazol-5-yl acetate
1-(4-fluorophenyl)-3-(3-methylphenyl)-4-{4-[(4-methylphenyl)carbamamido]phenyl}-1H-pyrazol-5-yl acetate
Compound characteristics
| Compound ID: | V001-4941 |
| Compound Name: | 1-(4-fluorophenyl)-3-(3-methylphenyl)-4-{4-[(4-methylphenyl)carbamamido]phenyl}-1H-pyrazol-5-yl acetate |
| Molecular Weight: | 534.59 |
| Molecular Formula: | C32 H27 F N4 O3 |
| Smiles: | CC(=O)Oc1c(c2ccc(cc2)NC(Nc2ccc(C)cc2)=O)c(c2cccc(C)c2)nn1c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 7.6514 |
| logD: | 7.6514 |
| logSw: | -5.7623 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.877 |
| InChI Key: | YVBOUQZLXBGMMD-UHFFFAOYSA-N |