4-{[2-fluoro-N-(2-methoxyethyl)benzamido]methyl}phenyl 4-fluorobenzene-1-sulfonate
Chemical Structure Depiction of
4-{[2-fluoro-N-(2-methoxyethyl)benzamido]methyl}phenyl 4-fluorobenzene-1-sulfonate
4-{[2-fluoro-N-(2-methoxyethyl)benzamido]methyl}phenyl 4-fluorobenzene-1-sulfonate
Compound characteristics
| Compound ID: | V001-5710 |
| Compound Name: | 4-{[2-fluoro-N-(2-methoxyethyl)benzamido]methyl}phenyl 4-fluorobenzene-1-sulfonate |
| Molecular Weight: | 461.48 |
| Molecular Formula: | C23 H21 F2 N O5 S |
| Smiles: | COCCN(Cc1ccc(cc1)OS(c1ccc(cc1)F)(=O)=O)C(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7048 |
| logD: | 3.7048 |
| logSw: | -3.9376 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.532 |
| InChI Key: | SMYVBTDHHIFRLE-UHFFFAOYSA-N |