ethyl 6,7-dimethyl-3-[4-(3-methylbenzene-1-sulfonyl)piperazin-1-yl]quinoxaline-2-carboxylate
Chemical Structure Depiction of
ethyl 6,7-dimethyl-3-[4-(3-methylbenzene-1-sulfonyl)piperazin-1-yl]quinoxaline-2-carboxylate
ethyl 6,7-dimethyl-3-[4-(3-methylbenzene-1-sulfonyl)piperazin-1-yl]quinoxaline-2-carboxylate
Compound characteristics
| Compound ID: | V001-5862 |
| Compound Name: | ethyl 6,7-dimethyl-3-[4-(3-methylbenzene-1-sulfonyl)piperazin-1-yl]quinoxaline-2-carboxylate |
| Molecular Weight: | 468.57 |
| Molecular Formula: | C24 H28 N4 O4 S |
| Salt: | not_available |
| Smiles: | CCOC(c1c(nc2cc(C)c(C)cc2n1)N1CCN(CC1)S(c1cccc(C)c1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2064 |
| logD: | 5.2064 |
| logSw: | -5.0212 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 73.6 |
| InChI Key: | BXZAEJKQNKHSJM-UHFFFAOYSA-N |