N-{[5-(2-methoxyphenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]-N'-propylurea
Chemical Structure Depiction of
N-{[5-(2-methoxyphenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]-N'-propylurea
N-{[5-(2-methoxyphenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]-N'-propylurea
Compound characteristics
| Compound ID: | V001-5924 |
| Compound Name: | N-{[5-(2-methoxyphenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]-N'-propylurea |
| Molecular Weight: | 478.59 |
| Molecular Formula: | C27 H34 N4 O4 |
| Salt: | not_available |
| Smiles: | CCCNC(N(CC1CCCO1)Cc1c(c2ccccc2)nn(C)c1Oc1ccccc1OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0654 |
| logD: | 4.0654 |
| logSw: | -4.2271 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.83 |
| InChI Key: | YPRSPHBXSUSDQI-OAQYLSRUSA-N |