N-{[5-(4-chlorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}-N-(cyclopropylmethyl)cyclopentanecarboxamide
Chemical Structure Depiction of
N-{[5-(4-chlorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}-N-(cyclopropylmethyl)cyclopentanecarboxamide
N-{[5-(4-chlorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}-N-(cyclopropylmethyl)cyclopentanecarboxamide
Compound characteristics
| Compound ID: | V001-7514 |
| Compound Name: | N-{[5-(4-chlorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}-N-(cyclopropylmethyl)cyclopentanecarboxamide |
| Molecular Weight: | 464.01 |
| Molecular Formula: | C27 H30 Cl N3 O2 |
| Smiles: | Cc1c(CN(CC2CC2)C(C2CCCC2)=O)c(n(c2ccccc2)n1)Oc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.3945 |
| logD: | 6.3945 |
| logSw: | -6.2051 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.941 |
| InChI Key: | KSFWYMRKAPWKPT-UHFFFAOYSA-N |