4-methoxy-N-({2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(prop-2-en-1-yl)benzamide
Chemical Structure Depiction of
4-methoxy-N-({2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(prop-2-en-1-yl)benzamide
4-methoxy-N-({2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(prop-2-en-1-yl)benzamide
Compound characteristics
| Compound ID: | V001-8388 |
| Compound Name: | 4-methoxy-N-({2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(prop-2-en-1-yl)benzamide |
| Molecular Weight: | 408.52 |
| Molecular Formula: | C23 H24 N2 O3 S |
| Smiles: | Cc1ccc(cc1)OCc1nc(CN(CC=C)C(c2ccc(cc2)OC)=O)cs1 |
| Stereo: | ACHIRAL |
| logP: | 4.6421 |
| logD: | 4.6421 |
| logSw: | -4.4191 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 42.195 |
| InChI Key: | AACLPHIYOYNHCL-UHFFFAOYSA-N |