N-{[5-(2-fluorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}-N-(2-methoxyethyl)cyclopropanecarboxamide
Chemical Structure Depiction of
N-{[5-(2-fluorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}-N-(2-methoxyethyl)cyclopropanecarboxamide
N-{[5-(2-fluorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}-N-(2-methoxyethyl)cyclopropanecarboxamide
Compound characteristics
| Compound ID: | V001-8541 |
| Compound Name: | N-{[5-(2-fluorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}-N-(2-methoxyethyl)cyclopropanecarboxamide |
| Molecular Weight: | 423.49 |
| Molecular Formula: | C24 H26 F N3 O3 |
| Salt: | not_available |
| Smiles: | Cn1c(c(CN(CCOC)C(C2CC2)=O)c(c2ccccc2)n1)Oc1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 3.6762 |
| logD: | 3.6762 |
| logSw: | -4.0604 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.405 |
| InChI Key: | SJPOPTJZXIFLPJ-UHFFFAOYSA-N |