4-fluoro-N-(2-methoxyethyl)-N-{[3-methyl-5-(3-methylphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}benzamide
Chemical Structure Depiction of
4-fluoro-N-(2-methoxyethyl)-N-{[3-methyl-5-(3-methylphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}benzamide
4-fluoro-N-(2-methoxyethyl)-N-{[3-methyl-5-(3-methylphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}benzamide
Compound characteristics
| Compound ID: | V002-0172 |
| Compound Name: | 4-fluoro-N-(2-methoxyethyl)-N-{[3-methyl-5-(3-methylphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}benzamide |
| Molecular Weight: | 473.55 |
| Molecular Formula: | C28 H28 F N3 O3 |
| Smiles: | Cc1cccc(c1)Oc1c(CN(CCOC)C(c2ccc(cc2)F)=O)c(C)nn1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.0245 |
| logD: | 5.0245 |
| logSw: | -4.8636 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.452 |
| InChI Key: | DNIXOBRIZGGXDE-UHFFFAOYSA-N |