3-{4-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]piperazine-1-carbonyl}benzonitrile
Chemical Structure Depiction of
3-{4-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]piperazine-1-carbonyl}benzonitrile
3-{4-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]piperazine-1-carbonyl}benzonitrile
Compound characteristics
| Compound ID: | V002-0265 |
| Compound Name: | 3-{4-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]piperazine-1-carbonyl}benzonitrile |
| Molecular Weight: | 527.97 |
| Molecular Formula: | C28 H25 Cl F3 N3 O2 |
| Salt: | not_available |
| Smiles: | C1CN(CCN1CC(c1ccc(cc1)[Cl])OCc1ccc(cc1)C(F)(F)F)C(c1cccc(C#N)c1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8478 |
| logD: | 4.8451 |
| logSw: | -5.2844 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 44.364 |
| InChI Key: | SITRLGHTRFNHQE-SANMLTNESA-N |