2-chloro-N-[(4-fluorophenyl)methyl]-N-{[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl}propanamide
Chemical Structure Depiction of
2-chloro-N-[(4-fluorophenyl)methyl]-N-{[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl}propanamide
2-chloro-N-[(4-fluorophenyl)methyl]-N-{[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl}propanamide
Compound characteristics
| Compound ID: | V002-0803 |
| Compound Name: | 2-chloro-N-[(4-fluorophenyl)methyl]-N-{[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl}propanamide |
| Molecular Weight: | 402.85 |
| Molecular Formula: | C21 H20 Cl F N2 O3 |
| Smiles: | CC(C(N(Cc1ccc(cc1)F)Cc1cc(c2cccc(c2)OC)on1)=O)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3257 |
| logD: | 4.3257 |
| logSw: | -4.4168 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.024 |
| InChI Key: | WLCBUBFVYJLSAE-AWEZNQCLSA-N |