N-(butan-2-yl)-N-({5-[(cyclobutanecarbonyl)amino]-2-(dimethylamino)phenyl}methyl)furan-2-carboxamide
Chemical Structure Depiction of
N-(butan-2-yl)-N-({5-[(cyclobutanecarbonyl)amino]-2-(dimethylamino)phenyl}methyl)furan-2-carboxamide
N-(butan-2-yl)-N-({5-[(cyclobutanecarbonyl)amino]-2-(dimethylamino)phenyl}methyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | V002-1378 |
| Compound Name: | N-(butan-2-yl)-N-({5-[(cyclobutanecarbonyl)amino]-2-(dimethylamino)phenyl}methyl)furan-2-carboxamide |
| Molecular Weight: | 397.52 |
| Molecular Formula: | C23 H31 N3 O3 |
| Salt: | not_available |
| Smiles: | CCC(C)N(Cc1cc(ccc1N(C)C)NC(C1CCC1)=O)C(c1ccco1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4 |
| logD: | 3.3894 |
| logSw: | -3.6431 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.474 |
| InChI Key: | YVSSIFSRFNYVSO-INIZCTEOSA-N |