2-{[N-cyclopropyl(ethyl)carbamamido]methyl}phenyl 4-methoxybenzene-1-sulfonate
Chemical Structure Depiction of
2-{[N-cyclopropyl(ethyl)carbamamido]methyl}phenyl 4-methoxybenzene-1-sulfonate
2-{[N-cyclopropyl(ethyl)carbamamido]methyl}phenyl 4-methoxybenzene-1-sulfonate
Compound characteristics
| Compound ID: | V002-1448 |
| Compound Name: | 2-{[N-cyclopropyl(ethyl)carbamamido]methyl}phenyl 4-methoxybenzene-1-sulfonate |
| Molecular Weight: | 404.48 |
| Molecular Formula: | C20 H24 N2 O5 S |
| Smiles: | CCNC(N(Cc1ccccc1OS(c1ccc(cc1)OC)(=O)=O)C1CC1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6656 |
| logD: | 3.6656 |
| logSw: | -3.8473 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.186 |
| InChI Key: | VAMGMVDIDXZYOZ-UHFFFAOYSA-N |