ethyl 1-{4-(2-fluorobenzamido)-2-[(1-phenylethyl)sulfamoyl]phenyl}piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-{4-(2-fluorobenzamido)-2-[(1-phenylethyl)sulfamoyl]phenyl}piperidine-3-carboxylate
ethyl 1-{4-(2-fluorobenzamido)-2-[(1-phenylethyl)sulfamoyl]phenyl}piperidine-3-carboxylate
Compound characteristics
| Compound ID: | V002-1464 |
| Compound Name: | ethyl 1-{4-(2-fluorobenzamido)-2-[(1-phenylethyl)sulfamoyl]phenyl}piperidine-3-carboxylate |
| Molecular Weight: | 553.65 |
| Molecular Formula: | C29 H32 F N3 O5 S |
| Salt: | not_available |
| Smiles: | CCOC(C1CCCN(C1)c1ccc(cc1S(NC(C)c1ccccc1)(=O)=O)NC(c1ccccc1F)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.8833 |
| logD: | 4.8246 |
| logSw: | -4.5298 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 88.303 |
| InChI Key: | ZAHOJAYNWMUNDD-UHFFFAOYSA-N |