1-(3-methylphenyl)-N-[3-(morpholin-4-yl)propyl]-5-(2-phenylethyl)-1H-1,2,4-triazole-3-carboxamide
Chemical Structure Depiction of
1-(3-methylphenyl)-N-[3-(morpholin-4-yl)propyl]-5-(2-phenylethyl)-1H-1,2,4-triazole-3-carboxamide
1-(3-methylphenyl)-N-[3-(morpholin-4-yl)propyl]-5-(2-phenylethyl)-1H-1,2,4-triazole-3-carboxamide
Compound characteristics
| Compound ID: | V002-1823 |
| Compound Name: | 1-(3-methylphenyl)-N-[3-(morpholin-4-yl)propyl]-5-(2-phenylethyl)-1H-1,2,4-triazole-3-carboxamide |
| Molecular Weight: | 433.55 |
| Molecular Formula: | C25 H31 N5 O2 |
| Smiles: | Cc1cccc(c1)n1c(CCc2ccccc2)nc(C(NCCCN2CCOCC2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.5154 |
| logD: | 3.1271 |
| logSw: | -3.6671 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.011 |
| InChI Key: | YJBPXDUBYCWDMY-UHFFFAOYSA-N |