[5-({benzyl[(furan-2-yl)methyl]amino}methyl)furan-2-yl](diphenyl)methanol
Chemical Structure Depiction of
[5-({benzyl[(furan-2-yl)methyl]amino}methyl)furan-2-yl](diphenyl)methanol
[5-({benzyl[(furan-2-yl)methyl]amino}methyl)furan-2-yl](diphenyl)methanol
Compound characteristics
| Compound ID: | V002-2018 |
| Compound Name: | [5-({benzyl[(furan-2-yl)methyl]amino}methyl)furan-2-yl](diphenyl)methanol |
| Molecular Weight: | 449.55 |
| Molecular Formula: | C30 H27 N O3 |
| Salt: | not_available |
| Smiles: | C(c1ccccc1)N(Cc1ccco1)Cc1ccc(C(c2ccccc2)(c2ccccc2)O)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.8172 |
| logD: | 5.753 |
| logSw: | -5.9186 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.794 |
| InChI Key: | GPJVBTKUICMTOI-UHFFFAOYSA-N |