N~2~-[(2,4-dichlorophenyl)carbamoyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[(3-methylthiophen-2-yl)methyl]-N~2~-propylglycinamide
Chemical Structure Depiction of
N~2~-[(2,4-dichlorophenyl)carbamoyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[(3-methylthiophen-2-yl)methyl]-N~2~-propylglycinamide
N~2~-[(2,4-dichlorophenyl)carbamoyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[(3-methylthiophen-2-yl)methyl]-N~2~-propylglycinamide
Compound characteristics
| Compound ID: | V002-2927 |
| Compound Name: | N~2~-[(2,4-dichlorophenyl)carbamoyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[(3-methylthiophen-2-yl)methyl]-N~2~-propylglycinamide |
| Molecular Weight: | 578.56 |
| Molecular Formula: | C28 H33 Cl2 N3 O4 S |
| Smiles: | CCCN(CC(N(CCc1ccc(c(c1)OC)OC)Cc1c(C)ccs1)=O)C(Nc1ccc(cc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.1295 |
| logD: | 6.129 |
| logSw: | -6.1368 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.492 |
| InChI Key: | MLUYBIOHHAPUTF-UHFFFAOYSA-N |