N-cyclopropyl-N-{2-[(4-{2-[(1,2-diphenylethyl)amino]-2-oxoethyl}-1,3-thiazol-2-yl)amino]-2-oxoethyl}benzamide
Chemical Structure Depiction of
N-cyclopropyl-N-{2-[(4-{2-[(1,2-diphenylethyl)amino]-2-oxoethyl}-1,3-thiazol-2-yl)amino]-2-oxoethyl}benzamide
N-cyclopropyl-N-{2-[(4-{2-[(1,2-diphenylethyl)amino]-2-oxoethyl}-1,3-thiazol-2-yl)amino]-2-oxoethyl}benzamide
Compound characteristics
| Compound ID: | V002-4094 |
| Compound Name: | N-cyclopropyl-N-{2-[(4-{2-[(1,2-diphenylethyl)amino]-2-oxoethyl}-1,3-thiazol-2-yl)amino]-2-oxoethyl}benzamide |
| Molecular Weight: | 538.67 |
| Molecular Formula: | C31 H30 N4 O3 S |
| Salt: | not_available |
| Smiles: | C1CC1N(CC(Nc1nc(CC(NC(Cc2ccccc2)c2ccccc2)=O)cs1)=O)C(c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4192 |
| logD: | 5.4172 |
| logSw: | -5.7129 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.003 |
| InChI Key: | IIAVNXTUVIUEAW-MHZLTWQESA-N |