N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-1-(2-methylphenyl)-1H-1,2,4-triazole-3-carboxamide
Chemical Structure Depiction of
N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-1-(2-methylphenyl)-1H-1,2,4-triazole-3-carboxamide
N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-1-(2-methylphenyl)-1H-1,2,4-triazole-3-carboxamide
Compound characteristics
| Compound ID: | V002-4963 |
| Compound Name: | N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-1-(2-methylphenyl)-1H-1,2,4-triazole-3-carboxamide |
| Molecular Weight: | 301.35 |
| Molecular Formula: | C15 H19 N5 O2 |
| Salt: | not_available |
| Smiles: | Cc1ccccc1n1cnc(C(N(C)CC(N(C)C)=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 0.2966 |
| logD: | 0.2966 |
| logSw: | -1.5105 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.772 |
| InChI Key: | OGWZBINCCNUSCX-UHFFFAOYSA-N |