[4-(2-methoxyphenyl)piperazin-1-yl][1-(3-methylphenyl)-5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]methanone
Chemical Structure Depiction of
[4-(2-methoxyphenyl)piperazin-1-yl][1-(3-methylphenyl)-5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]methanone
[4-(2-methoxyphenyl)piperazin-1-yl][1-(3-methylphenyl)-5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]methanone
Compound characteristics
| Compound ID: | V002-4977 |
| Compound Name: | [4-(2-methoxyphenyl)piperazin-1-yl][1-(3-methylphenyl)-5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]methanone |
| Molecular Weight: | 481.6 |
| Molecular Formula: | C29 H31 N5 O2 |
| Salt: | not_available |
| Smiles: | Cc1cccc(c1)n1c(CCc2ccccc2)nc(C(N2CCN(CC2)c2ccccc2OC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.5427 |
| logD: | 5.5425 |
| logSw: | -5.4212 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 52.104 |
| InChI Key: | PAOIOBIIHVXECN-UHFFFAOYSA-N |