N-{3-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}pentanamide
Chemical Structure Depiction of
N-{3-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}pentanamide
N-{3-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}pentanamide
Compound characteristics
| Compound ID: | V002-7386 |
| Compound Name: | N-{3-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}pentanamide |
| Molecular Weight: | 382.52 |
| Molecular Formula: | C22 H26 N2 O2 S |
| Smiles: | CCCCC(Nc1cccc(c1)C1N(C(CS1)=O)c1ccccc1CC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7571 |
| logD: | 4.7571 |
| logSw: | -4.4605 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.981 |
| InChI Key: | QAQPSICAELTEIC-QFIPXVFZSA-N |