5-(2H-1,3-benzodioxol-5-yl)-N-[(2-chloro-6-fluorophenyl)methyl]thiophene-2-carboxamide
Chemical Structure Depiction of
5-(2H-1,3-benzodioxol-5-yl)-N-[(2-chloro-6-fluorophenyl)methyl]thiophene-2-carboxamide
5-(2H-1,3-benzodioxol-5-yl)-N-[(2-chloro-6-fluorophenyl)methyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V002-8631 |
| Compound Name: | 5-(2H-1,3-benzodioxol-5-yl)-N-[(2-chloro-6-fluorophenyl)methyl]thiophene-2-carboxamide |
| Molecular Weight: | 389.83 |
| Molecular Formula: | C19 H13 Cl F N O3 S |
| Smiles: | C(c1c(cccc1[Cl])F)NC(c1ccc(c2ccc3c(c2)OCO3)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4436 |
| logD: | 5.4435 |
| logSw: | -6.0686 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.514 |
| InChI Key: | XWQLNUDZQHJLDC-UHFFFAOYSA-N |