N-{8-[(2,4-dimethoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl}decanamide
Chemical Structure Depiction of
N-{8-[(2,4-dimethoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl}decanamide
N-{8-[(2,4-dimethoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl}decanamide
Compound characteristics
| Compound ID: | V002-8987 |
| Compound Name: | N-{8-[(2,4-dimethoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl}decanamide |
| Molecular Weight: | 430.63 |
| Molecular Formula: | C26 H42 N2 O3 |
| Smiles: | CCCCCCCCCC(NC1CC2CCC(C1)N2Cc1ccc(cc1OC)OC)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.2521 |
| logD: | 4.252 |
| logSw: | -5.0234 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.353 |
| InChI Key: | KRENPAJRNPCZTJ-UHFFFAOYSA-N |