3-bromo-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)-N-[2-(piperidin-1-yl)ethyl]benzamide
Chemical Structure Depiction of
3-bromo-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)-N-[2-(piperidin-1-yl)ethyl]benzamide
3-bromo-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)-N-[2-(piperidin-1-yl)ethyl]benzamide
Compound characteristics
| Compound ID: | V003-0205 |
| Compound Name: | 3-bromo-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)-N-[2-(piperidin-1-yl)ethyl]benzamide |
| Molecular Weight: | 566.54 |
| Molecular Formula: | C30 H36 Br N3 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccc(CN(CCc2ccccc2)C(CN(CCN2CCCCC2)C(c2cccc(c2)[Br])=O)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.0098 |
| logD: | 4.4143 |
| logSw: | -4.6412 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.064 |
| InChI Key: | GQWFCRDKSRPEHX-UHFFFAOYSA-N |