N-{2-[3-(2,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-3,3-dimethylbutanamide
Chemical Structure Depiction of
N-{2-[3-(2,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-3,3-dimethylbutanamide
N-{2-[3-(2,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-3,3-dimethylbutanamide
Compound characteristics
| Compound ID: | V003-0394 |
| Compound Name: | N-{2-[3-(2,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-3,3-dimethylbutanamide |
| Molecular Weight: | 525.65 |
| Molecular Formula: | C29 H39 N3 O6 |
| Smiles: | CC(C)(C)CC(N(CCOC)CC(N1C(CC(c2ccc(cc2OC)OC)=N1)c1ccc(cc1)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6154 |
| logD: | 4.6154 |
| logSw: | -4.4562 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 73.853 |
| InChI Key: | BFEUEOBHLQXJKV-VWLOTQADSA-N |