4-chloro-N-{[5-(2,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl}-N-(2-methylpropyl)benzamide
Chemical Structure Depiction of
4-chloro-N-{[5-(2,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl}-N-(2-methylpropyl)benzamide
4-chloro-N-{[5-(2,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl}-N-(2-methylpropyl)benzamide
Compound characteristics
| Compound ID: | V003-0889 |
| Compound Name: | 4-chloro-N-{[5-(2,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl}-N-(2-methylpropyl)benzamide |
| Molecular Weight: | 428.91 |
| Molecular Formula: | C23 H25 Cl N2 O4 |
| Smiles: | CC(C)CN(Cc1cc(c2ccc(cc2OC)OC)on1)C(c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.1477 |
| logD: | 5.1477 |
| logSw: | -5.5209 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.654 |
| InChI Key: | KRHLRPRJNNBLPD-UHFFFAOYSA-N |