N-{[5-(2,4-difluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}-2-fluoro-N-(propan-2-yl)benzamide
Chemical Structure Depiction of
N-{[5-(2,4-difluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}-2-fluoro-N-(propan-2-yl)benzamide
N-{[5-(2,4-difluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}-2-fluoro-N-(propan-2-yl)benzamide
Compound characteristics
| Compound ID: | V003-1153 |
| Compound Name: | N-{[5-(2,4-difluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}-2-fluoro-N-(propan-2-yl)benzamide |
| Molecular Weight: | 479.5 |
| Molecular Formula: | C27 H24 F3 N3 O2 |
| Smiles: | CC(C)N(Cc1c(C)nn(c2ccccc2)c1Oc1ccc(cc1F)F)C(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7421 |
| logD: | 5.7421 |
| logSw: | -5.5639 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.961 |
| InChI Key: | OXBMYBQSLSWFBL-UHFFFAOYSA-N |