3-(2,5-dichlorophenyl)-2-{[(4-methoxyphenyl)methyl]sulfanyl}quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(2,5-dichlorophenyl)-2-{[(4-methoxyphenyl)methyl]sulfanyl}quinazolin-4(3H)-one
3-(2,5-dichlorophenyl)-2-{[(4-methoxyphenyl)methyl]sulfanyl}quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | V003-1365 |
| Compound Name: | 3-(2,5-dichlorophenyl)-2-{[(4-methoxyphenyl)methyl]sulfanyl}quinazolin-4(3H)-one |
| Molecular Weight: | 443.35 |
| Molecular Formula: | C22 H16 Cl2 N2 O2 S |
| Smiles: | COc1ccc(CSC2=Nc3ccccc3C(N2c2cc(ccc2[Cl])[Cl])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.0063 |
| logD: | 5.0063 |
| logSw: | -5.1053 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.402 |
| InChI Key: | MPRJZJKDBHZDKO-UHFFFAOYSA-N |