4-butyl-N-{4-[3-(3-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Chemical Structure Depiction of
4-butyl-N-{4-[3-(3-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
4-butyl-N-{4-[3-(3-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Compound characteristics
| Compound ID: | V003-1368 |
| Compound Name: | 4-butyl-N-{4-[3-(3-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide |
| Molecular Weight: | 444.6 |
| Molecular Formula: | C27 H28 N2 O2 S |
| Smiles: | CCCCc1ccc(cc1)C(Nc1ccc(cc1)C1N(C(CS1)=O)c1cccc(C)c1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.5708 |
| logD: | 6.5707 |
| logSw: | -5.5574 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.224 |
| InChI Key: | HMNDZUJVONCOQX-MHZLTWQESA-N |