4-butoxy-N-{4-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Chemical Structure Depiction of
4-butoxy-N-{4-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
4-butoxy-N-{4-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Compound characteristics
| Compound ID: | V003-1487 |
| Compound Name: | 4-butoxy-N-{4-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide |
| Molecular Weight: | 476.59 |
| Molecular Formula: | C27 H28 N2 O4 S |
| Smiles: | CCCCOc1ccc(cc1)C(Nc1ccc(cc1)C1N(C(CS1)=O)c1ccc(cc1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5027 |
| logD: | 5.5026 |
| logSw: | -5.3164 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.186 |
| InChI Key: | YDIBQPXMDMBIEL-MHZLTWQESA-N |