N-[(furan-2-yl)methyl]-N-[(3-methyl-5-phenoxy-1-phenyl-1H-pyrazol-4-yl)methyl]-N'-[4-(trifluoromethyl)phenyl]urea
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-N-[(3-methyl-5-phenoxy-1-phenyl-1H-pyrazol-4-yl)methyl]-N'-[4-(trifluoromethyl)phenyl]urea
N-[(furan-2-yl)methyl]-N-[(3-methyl-5-phenoxy-1-phenyl-1H-pyrazol-4-yl)methyl]-N'-[4-(trifluoromethyl)phenyl]urea
Compound characteristics
| Compound ID: | V003-1907 |
| Compound Name: | N-[(furan-2-yl)methyl]-N-[(3-methyl-5-phenoxy-1-phenyl-1H-pyrazol-4-yl)methyl]-N'-[4-(trifluoromethyl)phenyl]urea |
| Molecular Weight: | 546.55 |
| Molecular Formula: | C30 H25 F3 N4 O3 |
| Smiles: | Cc1c(CN(Cc2ccco2)C(Nc2ccc(cc2)C(F)(F)F)=O)c(n(c2ccccc2)n1)Oc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 6.8215 |
| logD: | 6.8215 |
| logSw: | -5.8076 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.429 |
| InChI Key: | KSXZANILDXPWHR-UHFFFAOYSA-N |