1-[(3,5-dimethylphenyl)methyl]-4-[(5-nitrofuran-2-carbonyl)amino]-1H-indol-5-yl diethylcarbamate
Chemical Structure Depiction of
1-[(3,5-dimethylphenyl)methyl]-4-[(5-nitrofuran-2-carbonyl)amino]-1H-indol-5-yl diethylcarbamate
1-[(3,5-dimethylphenyl)methyl]-4-[(5-nitrofuran-2-carbonyl)amino]-1H-indol-5-yl diethylcarbamate
Compound characteristics
| Compound ID: | V003-1982 |
| Compound Name: | 1-[(3,5-dimethylphenyl)methyl]-4-[(5-nitrofuran-2-carbonyl)amino]-1H-indol-5-yl diethylcarbamate |
| Molecular Weight: | 504.54 |
| Molecular Formula: | C27 H28 N4 O6 |
| Smiles: | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2cc(C)cc(C)c2)c1NC(c1ccc([N+]([O-])=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2568 |
| logD: | 5.2503 |
| logSw: | -5.2588 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 88.4 |
| InChI Key: | DIYCIKXYXFKQOQ-UHFFFAOYSA-N |