N-[2-(4-methylphenyl)ethyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-(4-methylphenyl)ethyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide
N-[2-(4-methylphenyl)ethyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V003-2383 |
| Compound Name: | N-[2-(4-methylphenyl)ethyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| Molecular Weight: | 389.44 |
| Molecular Formula: | C21 H18 F3 N O S |
| Smiles: | Cc1ccc(CCNC(c2ccc(c3cccc(c3)C(F)(F)F)s2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.7829 |
| logD: | 5.7829 |
| logSw: | -5.652 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.24 |
| InChI Key: | NRMRHXSWVCDNHN-UHFFFAOYSA-N |