(1-benzothiophen-2-yl)(4-{2-(4-chlorophenyl)-2-[(3-methoxyphenyl)methoxy]ethyl}piperazin-1-yl)methanone
Chemical Structure Depiction of
(1-benzothiophen-2-yl)(4-{2-(4-chlorophenyl)-2-[(3-methoxyphenyl)methoxy]ethyl}piperazin-1-yl)methanone
(1-benzothiophen-2-yl)(4-{2-(4-chlorophenyl)-2-[(3-methoxyphenyl)methoxy]ethyl}piperazin-1-yl)methanone
Compound characteristics
| Compound ID: | V003-2445 |
| Compound Name: | (1-benzothiophen-2-yl)(4-{2-(4-chlorophenyl)-2-[(3-methoxyphenyl)methoxy]ethyl}piperazin-1-yl)methanone |
| Molecular Weight: | 521.08 |
| Molecular Formula: | C29 H29 Cl N2 O3 S |
| Salt: | not_available |
| Smiles: | COc1cccc(COC(CN2CCN(CC2)C(c2cc3ccccc3s2)=O)c2ccc(cc2)[Cl])c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1076 |
| logD: | 6.105 |
| logSw: | -6.526 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.598 |
| InChI Key: | YEHIUQHHZVVKCN-SANMLTNESA-N |