5-(2,5-dimethylphenyl)-N-{3-[(2-methoxyethyl)amino]-3-oxopropyl}-N-(2-methylpropyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(2,5-dimethylphenyl)-N-{3-[(2-methoxyethyl)amino]-3-oxopropyl}-N-(2-methylpropyl)-1,2-oxazole-3-carboxamide
5-(2,5-dimethylphenyl)-N-{3-[(2-methoxyethyl)amino]-3-oxopropyl}-N-(2-methylpropyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | V003-2632 |
| Compound Name: | 5-(2,5-dimethylphenyl)-N-{3-[(2-methoxyethyl)amino]-3-oxopropyl}-N-(2-methylpropyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 401.51 |
| Molecular Formula: | C22 H31 N3 O4 |
| Smiles: | CC(C)CN(CCC(NCCOC)=O)C(c1cc(c2cc(C)ccc2C)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3139 |
| logD: | 3.3139 |
| logSw: | -3.4093 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.89 |
| InChI Key: | ZDYNXYMKUGANTQ-UHFFFAOYSA-N |