N-(2-{[(4-fluorophenyl)methyl][(furan-2-yl)methyl]amino}-2-oxoethyl)-N-[(oxolan-2-yl)methyl]decanamide
Chemical Structure Depiction of
N-(2-{[(4-fluorophenyl)methyl][(furan-2-yl)methyl]amino}-2-oxoethyl)-N-[(oxolan-2-yl)methyl]decanamide
N-(2-{[(4-fluorophenyl)methyl][(furan-2-yl)methyl]amino}-2-oxoethyl)-N-[(oxolan-2-yl)methyl]decanamide
Compound characteristics
| Compound ID: | V003-2846 |
| Compound Name: | N-(2-{[(4-fluorophenyl)methyl][(furan-2-yl)methyl]amino}-2-oxoethyl)-N-[(oxolan-2-yl)methyl]decanamide |
| Molecular Weight: | 500.65 |
| Molecular Formula: | C29 H41 F N2 O4 |
| Smiles: | CCCCCCCCCC(N(CC1CCCO1)CC(N(Cc1ccc(cc1)F)Cc1ccco1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6187 |
| logD: | 5.6187 |
| logSw: | -5.221 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.009 |
| InChI Key: | JBEOBZNYRBYEOA-HHHXNRCGSA-N |